On Target OPRD_HUMAN 0.06382979/CHEMBL411
For the given ligand CCCC, we have found in our database that, being scored 0.06382979, the most similar ligand is CHEMBL411. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL411 (Similar Ligand) |
|---|---|
| CCCC | CC\C(=C(\CC)/c1ccc(O)cc1)\c2ccc(O)cc2 |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000000 00000008 20000300 00010200 00000000 00000000 82000080 00000402 00000800 00180840 08100100 40008000 00000002 00000000 00000002 00000008 00000400 02000000 00000000 00020001 00000100 18000000 00008001 00400010 01000000 80000000 00522000 40000000 00400000 00020002 04000000 00000400 |