On Target CLTR1_HUMAN 0.03448276/CHEMBL22776
For the given ligand CCCC, we have found in our database that, being scored 0.03448276, the most similar ligand is CHEMBL22776. Check out the elaboration below.
| CCCC (Given Ligand) | CHEMBL22776 (Similar Ligand) |
|---|---|
| CCCC | O[C@H]([C@H](SCCC(=O)O)c1ccccc1CCCCCCCCc2ccccc2)C(=O)O |
|
|
|
|
|
|
| 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000001 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000000 00000000 00000000 | 00000012 01008000 0002252a 00110200 00080040 00000002 01001000 00000001 00400800 00084840 08101000 4000d000 04019100 40240000 00040020 00080108 2c000008 02000100 00402008 00400001 00000100 08000a00 05004640 00400010 00048a00 80000011 00000000 00000000 00001002 00020822 00020000 05010400 |