On Target NPFF1_HUMAN 0.041237112/CHEMBL3361436
For the given ligand S protein, we have found in our database that, being scored 0.041237112, the most similar ligand is CHEMBL3361436. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL3361436 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | NC(=N)NCC(=O)NCC1(Cc2ccc(cc2)c3ccccc3)CCN(Cc4ccccc4)CC1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00002000 01001200 00100102 04010e00 00000000 00000000 00000000 22003000 00300d40 000808c2 08300000 5003a800 0400a802 00202000 00000400 00140000 00030010 02000000 04000000 10000201 00000100 38058600 10000001 02500018 00000000 c0000000 40000000 90000040 08004110 0006000b 20044000 00000600 |