On Target DRD5_HUMAN 0.05263158/CHEMBL908
For the given ligand S protein, we have found in our database that, being scored 0.05263158, the most similar ligand is CHEMBL908. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL908 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CN(C)CC\C=C/1\c2ccccc2Sc3ccc(Cl)cc13 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00008000 0c800200 00120300 00110600 00062000 08100020 84080080 01004402 00000080 00180844 08200400 60008800 0a000004 00000001 80000002 00000000 04001400 02000044 00200000 00000000 80000000 18000100 00808000 00400019 01002000 a4000000 10402000 40001000 00400280 00070f02 04000000 00030620 |