On Target NPY5R_HUMAN 0.055555556/CHEMBL331019
For the given ligand S protein, we have found in our database that, being scored 0.055555556, the most similar ligand is CHEMBL331019. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL331019 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | O=C(CSc1ccncc1)Nc2ccc(cc2)C(=O)c3ccccc3 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00004002 00000a00 20004100 c0110601 00050000 80000000 00010000 01000000 00020000 02084c40 08280004 60008000 00008803 00148000 00000040 00040004 04040008 02000000 08200000 00020000 40100000 0a028600 20802000 00400014 00000000 a0000000 00004000 408000c0 00008080 00060043 90000000 02010620 |