On Target 5HT1E_HUMAN 0.0390625/CHEMBL432713
For the given ligand S protein, we have found in our database that, being scored 0.0390625, the most similar ligand is CHEMBL432713. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL432713 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | Oc1ccc2[nH]cc(C3CCN(CCCCCNC(=O)\C=C\c4ccc(Cl)c(Cl)c4)CC3)c2c1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00008002 01009a08 20100100 40810610 00041200 00000000 86102080 20000400 01c00800 004a08c0 08300004 50018800 0a008806 00410800 80000042 0004000c 20000400 02000100 00218400 00820201 40000100 18048728 20800000 80500018 00042000 80100000 085e2000 50010000 00400000 0006030b 04040200 02022620 |