On Target PTAFR_HUMAN 0.040983606/CHEMBL300644
For the given ligand S protein, we have found in our database that, being scored 0.040983606, the most similar ligand is CHEMBL300644. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL300644 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | COc1ccc(cc1OC)c2ccc(cc2)\C(=N\CCCCc3cccnc3)\S |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00002002 41044008 2020610a 0c910610 40041100 00000000 12062000 00000000 00500900 000808c1 80100004 40018800 00005812 0024a800 01040001 000c800c 00020848 02000104 04280400 10021201 40000100 38008000 30800001 02400032 80040000 80000000 48020000 00000040 08404208 0006000a 40081000 00010400 |