On Target NK1R_HUMAN 0.046875/CHEMBL143813
For the given ligand S protein, we have found in our database that, being scored 0.046875, the most similar ligand is CHEMBL143813. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL143813 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | FC(F)(F)c1cc(CCCC2(CCNCC2)c3ccccc3)cc(c1)C(F)(F)F |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000000 01090200 00100102 00010600 00000001 00000000 00000400 20000000 00000800 000808d0 08300000 50018002 00000002 01200000 00000000 000c0008 00000000 02000000 00002000 00000201 00000100 18000010 01000000 00500010 00000000 80000000 00000000 90000000 00000002 0006000a 00120000 00000600 |