On Target NPSR1_HUMAN 0.035714287/CHEMBL1315807
For the given ligand S protein, we have found in our database that, being scored 0.035714287, the most similar ligand is CHEMBL1315807. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL1315807 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | [Br-].Cc1c(n2ccccc2[n+]1CCc3ccccc3)P(=S)(c4ccccc4)c5ccccc5 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000082 00030220 10106100 10410618 200c1268 80005000 0004f10c 40000000 0c100100 000808fe 8900800d 48018a00 00041800 00940000 080602c0 0b3c0005 0813007d 12003100 00780000 40000000 f0000000 18008c30 21800001 81420110 00048002 c000a000 08009000 70000000 17200004 0056020a 400c000c 0005d480 |