On Target CCR4_HUMAN 0.04597701/CHEMBL206878
For the given ligand S protein, we have found in our database that, being scored 0.04597701, the most similar ligand is CHEMBL206878. Check out the elaboration below.
| S protein (Given Ligand) | CHEMBL206878 (Similar Ligand) |
|---|---|
| C=[P+2](C)(C)(C)(C)C(C)C | CC(C)(C)c1coc(Nc2cccc3ccccc23)n1 |
|
|
|
|
|
|
| 00000000 00000200 00000000 00000000 10000000 00000000 00000000 00000000 00000000 00000000 00000000 40000000 00000000 00008000 00000000 00000000 00000008 00000000 00000000 10000000 00000000 00000000 00000000 00000010 00000000 00000000 00000000 00000000 00000000 00000300 00000000 00008000 | 00000002 00000800 000a0000 00000208 11000001 00000040 00000400 00000000 00004300 000c0850 00208004 40008000 80020400 00200000 00020040 100c0084 00040020 12004000 08001400 50a00000 54080000 08422008 24008800 04100014 00000000 00004800 00000000 18010080 0000800d 00060000 c0040000 20000002 |