On Target CCR2_HUMAN 0.4408602/CHEMBL3753178
For the given ligand Oseltamivir, we have found in our database that, being scored 0.4408602, the most similar ligand is CHEMBL3753178. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3753178 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | C[C@H]1CC=C(C(=O)O)[C@@](C)(C1)c2cc(C)cc(C)c2 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00010000 01000000 00000102 00010200 00080001 00800000 00000081 08000402 01000800 00980840 08100000 40009000 04028028 00a00000 00000400 00080008 00000000 02100020 00612018 00000801 00000100 08000a80 01008040 00400010 00201800 80000400 00404000 80000000 00000002 00020002 24020000 00000400 |