On Target ACM2_HUMAN 0.52040815/CHEMBL74305
For the given ligand Oseltamivir, we have found in our database that, being scored 0.52040815, the most similar ligand is CHEMBL74305. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL74305 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CCN(CC)CCOCCOC(=O)C1(CCCC1)c2ccc(OC)cc2 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00010000 01000008 2000050a 80010700 000810c0 00000000 02040000 00000040 00002800 00080840 08300000 40009000 0500800a 00a00000 41041009 00099008 18820000 02000000 04402000 00020001 00010120 08000a00 17000000 08400010 00000400 80000000 00120000 00000021 00000202 01060002 00002000 00000600 |