On Target CNR2_HUMAN 0.6666667/CHEMBL1923764
For the given ligand Oseltamivir, we have found in our database that, being scored 0.6666667, the most similar ligand is CHEMBL1923764. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1923764 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CCCCCCC(C)(C)c1cc(O)cc(OCCCCCCCCCCCC(=O)OC(CO)CO)c1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04010001 43000008 2000050a 00010300 00081000 42000000 42000000 00000000 00000800 00080840 08100000 40009000 0480800a 20a00080 11000001 0008b008 00820000 02000000 01482000 00020a01 00000120 08000a00 05000000 08400010 00000400 80000000 00000000 00000020 00010202 00020002 00020000 00000400 |