On Target CNR1_HUMAN 0.62637365/CHEMBL947
For the given ligand Oseltamivir, we have found in our database that, being scored 0.62637365, the most similar ligand is CHEMBL947. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL947 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CCCCCCC(C)(C)c1cc(O)c2[C@@H]3CC(=O)CC[C@H]3C(C)(C)Oc2c1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 04010001 43000018 2000010a 00010300 00081000 c2000000 46000000 00000200 00000900 00080840 08100000 40009840 0480802a 20a00080 11000001 00082008 00800000 22008000 02482008 00020a01 00000100 08000200 01000040 00400410 00000800 c0000000 00000000 00000000 00010302 00034002 00020000 00000400 |