On Target 5HT5A_HUMAN 0.44329897/CHEMBL278751
For the given ligand Oseltamivir, we have found in our database that, being scored 0.44329897, the most similar ligand is CHEMBL278751. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL278751 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | CCCN(CCC)[C@@H]1CCc2c(OC)cccc2[C@@H]1C |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000000 43000208 2010010a 00010600 00001020 c0000002 02000000 20000201 00000880 000808c0 08300000 40808040 00000002 20200000 01000001 02042008 00000200 02000000 00082000 00020201 00000100 18200000 00004000 81400410 00000000 c0000001 00000000 10000000 04000302 0006c00a 00000000 00002600 |