On Target DRD2_HUMAN 0.52040815/CHEMBL330865
For the given ligand Oseltamivir, we have found in our database that, being scored 0.52040815, the most similar ligand is CHEMBL330865. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL330865 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc2C(=O)C(CCc2c1)C3CCN(CCc4ccccc4)CC3 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00010000 43000808 2010010b 00010600 00001000 40008002 02040000 20000001 00000880 000808c0 08300000 50019000 04008012 20200000 01000021 00000008 00000200 02000000 00082000 00020201 00400100 18220250 00004000 81500014 00000000 80000001 00120000 10000000 04000202 00060002 80020000 00402600 |