On Target MC4R_HUMAN 0.38/CHEMBL225856
For the given ligand Oseltamivir, we have found in our database that, being scored 0.38, the most similar ligand is CHEMBL225856. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL225856 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc(cc1)C(CN2CCN(CCCCc3cccc4ccccc34)CC2)N5CCN(C)CC5 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000000 01000008 2010010a 04010600 00001000 00000000 02040000 22001000 00100880 000908c0 08300000 40018000 00000802 00202000 01000401 00000008 00000000 02000000 00000000 00020201 00000100 38208008 00000023 83500010 00000000 c0000000 00320000 90000000 0c000300 00060002 00040000 00000600 |