On Target NPSR1_HUMAN 0.31736526/CHEMBL1801360
For the given ligand Oseltamivir, we have found in our database that, being scored 0.31736526, the most similar ligand is CHEMBL1801360. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL1801360 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc2c(c1)C(CCC(=O)N3[C@H](C)CC[C@@H]3C)(c4ccc(Cl)cc4)n5ccnc25 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 0003c102 47801208 2010010a 10010600 20081060 40002010 02040400 21081000 80300900 100818c4 08308008 40039800 07009866 20a00000 018200a1 020d000c 00000000 0e002080 00482000 00420201 80100100 38048710 21005040 81528019 00002000 e0000001 00060100 50014080 06000284 0046080b 400c0800 00422600 |