On Target ACM5_HUMAN 0.47368422/CHEMBL3629534
For the given ligand Oseltamivir, we have found in our database that, being scored 0.47368422, the most similar ligand is CHEMBL3629534. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL3629534 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | COc1ccc(CCC(=O)OCC2(CCN(C)CC2)c3ccccc3)cc1 |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00000040 01000208 20100108 00010700 00101040 00000000 02040000 20000040 00000800 000808c0 08300000 50019000 04008002 00000000 01040001 000c1008 08020000 02000000 04400008 00020201 00010120 18000a00 01000040 00500010 00000c00 80000000 00120200 10000000 00000200 0006000a 00000000 00000e00 |