On Target GRM6_HUMAN 0.22077923/CHEMBL280563
For the given ligand Oseltamivir, we have found in our database that, being scored 0.22077923, the most similar ligand is CHEMBL280563. Check out the elaboration below.
| Oseltamivir (Given Ligand) | CHEMBL280563 (Similar Ligand) |
|---|---|
| CCCCC[C@H](O)CC(=O)CCc1ccc(O)c(OC)c1 | N[C@@H]([C@H]1C[C@@H]1C(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010000 43000008 2000010a 00010200 00081000 40000000 02000000 00000000 00000800 00080840 08100000 40009000 1400c00a 20a00000 01000001 00088008 00000000 02000000 00482008 00020201 00000100 08000200 01000000 00400010 00000800 80000000 00120000 00000000 00000202 00020002 00020000 00000400 | 00030000 01000000 00000000 00000400 00180000 00000000 00000000 00000000 00000000 00020080 00000000 40013000 04008038 03800000 00000000 00080008 00000000 00000000 00402000 00000001 00000000 10000a00 03000000 00000010 00000000 00000000 00000000 00000000 00000000 00040000 00000000 00000000 |