On Target CCR2_HUMAN 0.5566038/CHEMBL2036755
For the given ligand fentanyl, we have found in our database that, being scored 0.5566038, the most similar ligand is CHEMBL2036755. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL2036755 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | Clc1ccc(NC(=O)N2CCN(C[C@@H]3CCCN(CCc4ccccc4)C3)CC2)cc1Cl |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00008006 01002400 00100100 06010e00 00000000 00000000 08000004 20002009 00000080 000a09e0 08280004 50018800 0200a006 00102001 00000040 00000000 00040010 02400000 08000000 00004201 40000100 38210520 20022021 83500018 00102000 80100000 00080000 10000080 0c008000 00060013 00000000 02026600 |