On Target NPY1R_HUMAN 0.4509804/CHEMBL564810
For the given ligand fentanyl, we have found in our database that, being scored 0.4509804, the most similar ligand is CHEMBL564810. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL564810 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | C[C@@H](N[C@@H]1CC[C@@H](C(=O)N2CCC(CC2)(C(=O)N3CCCC3)c4ccccc4)C(C)(C)C1)c5ccccc5 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00030000 01001200 00100100 00010600 00000000 00000010 00000000 22001000 00200880 000808c0 08300000 50039000 0500881a 00000000 40000400 00040000 00000000 02000000 02002000 00000201 00000100 18248630 00000000 81500018 00000000 c0000000 00000000 90000000 04000100 0006000b 20062000 00802600 |