On Target DRD1_HUMAN 0.5/CHEMBL476108
For the given ligand fentanyl, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL476108. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL476108 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | Fc1ccc(cc1)C(=O)CCCN2CCCN(CC2)c3ccc(Cl)cc3 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 0002c002 01000c00 00100122 06010600 20000000 00000010 00000000 20000000 00100800 00080be0 08300004 40019800 06008006 00203000 00220040 00000000 00040000 02000080 08000000 00100201 68100100 38020300 20000001 02500016 00002000 80000000 00080000 10000081 08008000 00068012 80000000 02822600 |