On Target NPY5R_HUMAN 0.5981308/CHEMBL2013017
For the given ligand fentanyl, we have found in our database that, being scored 0.5981308, the most similar ligand is CHEMBL2013017. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL2013017 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CC(C)S(=O)(=O)NC[C@@H]1CC[C@H](CC1)NC(=O)CCN2CCc3ccccc23 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00004002 05001400 00100100 01310600 20000000 00000040 00000000 20000000 00000080 004809e0 08202404 50019000 08008002 00040001 80420140 00000002 00048000 02000000 0a002010 00004201 60100000 1c240630 20000000 91500039 02001000 80000000 00000000 1000108c 04088000 00060013 00020000 20012670 |