On Target GRM5_HUMAN 0.47524753/CHEMBL2338572
For the given ligand fentanyl, we have found in our database that, being scored 0.47524753, the most similar ligand is CHEMBL2338572. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL2338572 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CN(C)c1ccc(cc1)C(=O)N[C@H]2CCC[C@@H](C2)NC(=O)c3cccc(Cl)c3 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 00008002 09001c00 00100100 80010600 00000000 00000000 04000000 22001000 00000000 000009e8 00200004 40018800 02008806 00008000 80000440 00000000 00040000 02000000 0a002000 00000201 40000000 180e8730 20000000 0050001c 00002000 c0000000 00000000 90000080 00008100 00060811 a0040000 00020200 |