On Target AA1R_HUMAN 0.36024845/CHEMBL1095812
For the given ligand fentanyl, we have found in our database that, being scored 0.36024845, the most similar ligand is CHEMBL1095812. Check out the elaboration below.
| fentanyl (Given Ligand) | CHEMBL1095812 (Similar Ligand) |
|---|---|
| CCC(=O)N(c1ccccc1)C3CCN(CCc2ccccc2)CC3 | CCN1CCC(CC1)Nc2ccc3C(=O)c4c(nc(N)nc4c3c2)c5ccccc5 |
|
|
|
|
|
|
| 00004002 01001400 00100100 00010600 20000000 00000000 00000000 20000000 00000080 000809e0 08280004 50019000 00008002 00100000 00020040 00000000 00040000 02000000 08000000 00000201 60100000 18280600 20002000 81500018 00000000 80000000 00000000 10000080 04008000 00060013 00000000 00002600 | 0800e002 01000c01 c0100180 c0050e10 21000004 0001c000 00002401 21080000 04c00100 000809f0 28218004 7001a810 03808002 00308000 a0820140 000ca00c 00070000 06003000 0c408000 40200201 e0100000 1c020600 30806850 0050011c 00840000 81080000 00000200 500040e1 0240c08c 00460013 c0000800 000006a0 |