On Target GRM5_HUMAN 0.36180905/CHEMBL4072424
For the given ligand Captagon, we have found in our database that, being scored 0.36180905, the most similar ligand is CHEMBL4072424. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL4072424 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | O=C1C=C(OCCC2CC2)N=C3COC[C@@H](Cc4ccccc4)N13 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 04004002 09000218 ba900108 90010700 80080020 0200c000 04001800 00001008 06110b02 800a08e0 0814080c 40018000 02009084 01c80000 51021280 001e700c 40a08000 02888008 50440000 00440001 80020120 18000050 a3c03043 85700110 02000440 c0000004 20020280 10040030 14004204 0046040a d0884000 48240480 |