On Target ADRB3_HUMAN 0.5503356/CHEMBL3764950
For the given ligand Captagon, we have found in our database that, being scored 0.5503356, the most similar ligand is CHEMBL3764950. Check out the elaboration below.
| Captagon (Given Ligand) | CHEMBL3764950 (Similar Ligand) |
|---|---|
| CC(Cc1ccccc1)NCCn2cnc3c2c(=O)n(C)c(=O)n3C | O[C@@H]([C@H]1CC[C@@H](Cc2ccc(NC(=O)CN3C=NC=CC3=O)cc2)N1)c4ccccc4 |
|
|
|
|
|
|
| 0000002a 00801c00 00180100 42010700 00180040 0000c080 00008000 00000000 06600980 800808e0 0c30900c 40008000 00009002 01400000 00280880 000c000c 00800000 02088000 00400000 00000201 80000100 38200040 21800041 83700014 00040000 c0200000 60000000 00040000 0c004000 00460012 c0080000 00000e80 | 00004002 01000800 00100122 40010600 00180080 00006010 00000000 00000000 06200981 00080ae0 0838100c 4001a000 00009002 01f08000 000808c0 040c000c 10040000 42008000 08402000 00000201 e0100100 38200630 23802041 81700016 0c000000 80000000 20000000 00040080 0c00c002 00460013 400a0000 00002e80 |