On Target 5HT2B_HUMAN 0.5752688/CHEMBL1110
For the given ligand Molecule, we have found in our database that, being scored 0.5752688, the most similar ligand is CHEMBL1110. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL1110 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1[nH]cnc1CN2CCc3c(C2=O)c4ccccc4n3C |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1400000a 01805800 00100120 10010e10 00041060 00108000 00004000 0a00300d 00000180 00080ac0 49218004 40818800 00009882 00708000 010204c0 020c0004 00022208 8a800026 80200000 40000a01 c0820000 18278e58 21804000 8340041c 00045000 c1000400 18004000 80000000 04000104 00460043 e00c8200 a0000620 |