On Target DRD4_HUMAN 0.5084746/CHEMBL1771114
For the given ligand Molecule, we have found in our database that, being scored 0.5084746, the most similar ligand is CHEMBL1771114. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL1771114 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | COc1ccccc1N2CCN(CCCCN3CCc4cc(ccc4C3=O)C#C)CC2 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0000400a 00001808 20100928 54090600 80403021 00008000 02000000 22001004 00200180 00080ac0 08200004 40028000 80008882 00202000 01000441 00084008 00040200 02000020 08000000 00020211 40920000 38268640 20004021 8340801e 00000004 c0040000 2000c000 90000080 0c008300 00060003 a0040800 00002600 |