On Target AGTR2_HUMAN 0.44660193/CHEMBL2435833
For the given ligand Molecule, we have found in our database that, being scored 0.44660193, the most similar ligand is CHEMBL2435833. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL2435833 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CCCc1nc2c(C)cc(cc2n1Cc3ccc(cc3)c4ccccc4C(=O)O)C(=O)N5CCCCC5 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0800a00a 01809a01 00101500 10050610 000c0061 0000c000 10000000 22001004 80500100 100018d0 0120800c 50818800 82009882 00608000 200304c0 0a0c000c 00020008 06800004 04680008 50010201 c0000000 18068e30 31800041 8150041c 00044000 c0000000 08000040 90000040 04404104 00c60809 e00c8004 200006a0 |