On Target DRD3_HUMAN 0.5151515/CHEMBL85606
For the given ligand Molecule, we have found in our database that, being scored 0.5151515, the most similar ligand is CHEMBL85606. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL85606 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | O=C(N[C@@H]1CC[C@@H](CCN2CCc3cc(ccc3C2)C#N)CC1)c4ccnc5ccccc45 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0000000a 01001800 00104100 10010600 00041021 00000000 00000000 22001004 00000180 008808c0 08200004 40818000 80008882 00600000 00000440 000c000c 00400208 02000024 02a02000 00000201 40020000 18268618 20804400 8150001c 00004000 c0000000 00004000 90000000 04000100 00060403 a0068000 00002620 |