On Target GRM3_HUMAN 0.29310346/CHEMBL1629855
For the given ligand Molecule, we have found in our database that, being scored 0.29310346, the most similar ligand is CHEMBL1629855. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL1629855 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1cc(cc(C)n1)c2cccc(c2)C3=Nc4cc(C)c(cc4NC(=O)C3)C(F)(F)F |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 00016006 00040a00 42104100 18011620 24840061 80002006 10000410 00100000 00100980 000a08d1 0a390004 60009014 84008800 49308000 040600c0 0a0c000c 00060808 02005000 0c200008 00000211 44100100 18028600 31802000 00401818 000c0800 8c1000a2 40000660 900010c1 0048c80c 0006000b 40101001 00000620 |