On Target PTAFR_HUMAN 0.44324324/CHEMBL294706
For the given ligand Molecule, we have found in our database that, being scored 0.44324324, the most similar ligand is CHEMBL294706. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL294706 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC(C)c1ccc2N=C3C=CC(=CN3C(=O)c2c1)C(=O)NCCCCc4cncnc4 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10000002 0180d800 00106102 00810610 00041100 00004020 00006000 22001000 06500900 400808e0 6d200004 40018000 00008802 00e00800 00100440 000c0004 00020000 0200c004 00600000 40000201 c0000000 18048e28 20804040 8050041c 00040000 c0000001 28000000 90040000 00404100 00460003 e0040000 a0000680 |