On Target CNR1_HUMAN 0.672956/CHEMBL1950342
For the given ligand Molecule, we have found in our database that, being scored 0.672956, the most similar ligand is CHEMBL1950342. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL1950342 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CC1CCN(CC1)C(=O)c2ccc3[nH]c4CCN(Cc4c3c2)C5CCCC5 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 1400000a 0100d800 00100120 50010610 00041021 00000000 00004000 22001000 00000180 00080ac0 09208004 50818000 80008882 00608000 01020440 02040004 00020208 0a000024 00200000 00000201 40020000 18268e08 20804000 8150001c 00045000 c0000000 08004040 90000000 04400104 01060003 a0048200 a0002620 |