On Target V1AR_HUMAN 0.49171272/CHEMBL3416864
For the given ligand Molecule, we have found in our database that, being scored 0.49171272, the most similar ligand is CHEMBL3416864. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL3416864 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | Cc1c(C(=O)N2CCC(O)(Cc3ccccc3)CC2)c4ccccc4n1Cc5ccccc5 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 10000002 01801a00 00100102 10010610 00041060 00008000 00004000 22001004 80100800 000808c0 09300004 50018000 00009822 00608000 00060440 020c000c 08020008 82800004 00a80000 00000201 c0020100 18168e18 21800080 8150001c 00044001 c0000000 08004000 90000000 04000104 0006004b a00c8200 80000620 |