On Target EDNRA_HUMAN 0.4234234/CHEMBL3752680
For the given ligand Molecule, we have found in our database that, being scored 0.4234234, the most similar ligand is CHEMBL3752680. Check out the elaboration below.
| Molecule (Given Ligand) | CHEMBL3752680 (Similar Ligand) |
|---|---|
| Cc4cccc(C#Cc3ccc2C(=O)N(C1CCCC1)CCc2n3)c4 | CCCc1nc2c(C)cc(cc2n1Cc3ccc(cc3)c4ccccc4C(=O)Nc5nnn[nH]5)C(=O)NCCc6ccccc6 |
|
|
|
|
|
|
| 1400020a 01829800 00104922 50090690 0044b021 01008000 00004000 2200100c 00000180 00080ad1 09218004 40818000 80008882 00200000 01020480 0204000c 00228200 0a000024 00200000 00000211 c0820001 18a48e40 20804001 8350011c 00241004 c0040000 48004040 90001800 04400104 01060043 a0000000 a000a600 | 0800200a 00809a19 40101500 10050610 000c0061 0000c008 10000000 02101004 80500180 100818d0 0930800c 40818000 80009982 00608000 200304c0 0a0c400c 00020008 06800804 04680008 50410201 c0060300 18268630 31810061 8150841c 00044000 c0400000 28000040 80000040 0440410c 00c6080b e00c8004 280006a0 |