On Target CXCR2_HUMAN 0.33333334/CHEMBL3645131
For the given ligand Cocaine, we have found in our database that, being scored 0.33333334, the most similar ligand is CHEMBL3645131. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL3645131 (Similar Ligand) |
|---|---|
| CN1C3CCC1C(C(=O)O)C(OC(=O)c2ccccc2)C3 | CC(CCc1ccccc1)Oc2c(ccc3ccccc23)C(=O)NC4(CCCC4)C(=O)O |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 04018008 01005808 2010010a 00010700 00081080 02020100 02000000 22001400 00000800 001808c0 08300000 4001b020 0680880a 00a00000 11000401 00082008 10000000 22008000 00402000 00020201 00000140 18068e08 03000040 0050001c 00000000 c0000000 00000800 90000000 00000300 01060003 a4044000 00000600 |