On Target CXCR1_HUMAN 0.25365853/CHEMBL556862
For the given ligand Cocaine, we have found in our database that, being scored 0.25365853, the most similar ligand is CHEMBL556862. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL556862 (Similar Ligand) |
|---|---|
| CN1C3CCC1C(C(=O)O)C(OC(=O)c2ccccc2)C3 | CC[C@@H](NC1=C(Nc2cccc(C(=O)N3CCCC3C(=O)O)c2O)C(=O)C1=O)c4ccccc4 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 1041c00a 01005808 60100102 00012600 20090081 68022010 020000a0 22401500 05a00c40 001808d0 08380004 5043b000 0e008812 01200000 800a0440 10086048 10050001 22008000 08630210 20020201 48100980 18168e00 23000000 0050801c 04041000 c0000080 20400010 900c0580 20508102 20060003 a4045420 40002600 |