On Target ADRB1_HUMAN 0.45901638/CHEMBL1085395
For the given ligand Cocaine, we have found in our database that, being scored 0.45901638, the most similar ligand is CHEMBL1085395. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL1085395 (Similar Ligand) |
|---|---|
| CN1C3CCC1C(C(=O)O)C(OC(=O)c2ccccc2)C3 | CC(=O)O.OCc1cc(ccc1O)[C@@H](O)CNCCCCCCOCCOCc2ccccc2 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00000000 01000008 a0100100 00010700 00081091 00004000 02000000 20000840 00002180 000808c0 a8200000 40018000 00008002 00810000 00080000 0208b008 10800000 02000000 00402000 40020201 00000020 18200a30 07000000 89500010 00000400 80002000 005a0000 10000020 04000200 00060002 40000000 00002600 |