On Target OPRM_HUMAN 0.5315315/CHEMBL255768
For the given ligand Cocaine, we have found in our database that, being scored 0.5315315, the most similar ligand is CHEMBL255768. Check out the elaboration below.
| Cocaine (Given Ligand) | CHEMBL255768 (Similar Ligand) |
|---|---|
| CN1C3CCC1C(C(=O)O)C(OC(=O)c2ccccc2)C3 | CN(C)C[C@H]1CCCC[C@]1(OCC2CC2)c3cccc(O)c3 |
|
|
|
|
|
|
| 00010000 01000800 00100100 00010700 000c0050 00204010 00000000 20000000 00000100 010008c0 00200000 50019000 1c00801a 01890000 00000000 02081008 00a20000 02000000 01c02010 00000201 00000020 18020a30 01000080 00500014 00001401 80002000 00088000 10001000 00000200 0006000e c0020000 02002200 | 00000040 4b000208 20100102 00010700 00080010 40004000 02000000 00000000 00000900 000808c8 08300000 40018000 00000002 01a90000 00000000 020c1008 00a00000 02000000 02c02000 00020201 00000120 18000030 01000080 00500010 00000400 80002000 00080000 10000000 00000202 0006000a 40020000 02000600 |