On Target GRM4_HUMAN 0.32692307/CHEMBL2023624
For the given ligand Tramadol, we have found in our database that, being scored 0.32692307, the most similar ligand is CHEMBL2023624. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL2023624 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | O=C(Oc1ccc2c(ccnc2c1)c3cnn(c3)c4ccccc4)N5CCCCC5 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000006 41001a08 60104188 00010e10 200c1000 0000c008 06000000 00001008 04000300 000108c0 01200004 70018000 80008802 00400000 01030041 801e000c 00020040 82480004 04680100 00261201 40000040 18078c78 30800800 83502018 00000001 80010022 00000000 10000040 04004280 10460009 c0040000 b02006a0 |