On Target GRM2_HUMAN 0.6292135/CHEMBL341457
For the given ligand Tramadol, we have found in our database that, being scored 0.6292135, the most similar ligand is CHEMBL341457. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL341457 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cccc(CC[C@@](N)(C2C[C@@H]2C(=O)O)C(=O)O)c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00030000 43000208 2000010a 00010600 00181000 40000000 02000000 00000000 00000800 000a08c0 08100000 4001b000 0400803a 23a00000 01000001 00080008 00000000 02000000 00482000 00020201 00000100 18000a00 03000000 00400010 00000000 80000000 00000000 00000000 00000202 0006000a 00020000 00400400 |