On Target AGTR2_HUMAN 0.3888889/CHEMBL154057
For the given ligand Tramadol, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL154057. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL154057 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1ccc2CN(C(Cc2c1OCc3ccccc3)C(=O)O)C(=O)C(C4CCCC4)c5ccccc5 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 04018008 47805008 2010010a 10210600 000010a0 c0004000 07041000 22001204 00000980 000808c0 08300000 4001b0c0 0780c88a 20210080 c1080481 0208a008 90000200 02008020 00482008 00020201 80020100 18208e30 03004040 81d49418 00004800 c0002001 00224000 90000000 04000302 0187000b 60066000 00002600 |