On Target ADA2C_HUMAN 0.592233/CHEMBL476839
For the given ligand Tramadol, we have found in our database that, being scored 0.592233, the most similar ligand is CHEMBL476839. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL476839 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1c(OCCF)cccc1C(O)C2CCN(CCc3ccc(C)cc3)CC2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 06000000 4b000008 2010010a 00210600 00101000 40004000 02000000 21000a00 00100980 000808c0 08300000 50018840 00804002 20200080 01000005 0208a008 00000000 02000000 00480400 00020201 00000100 18200020 01000000 81500410 00000000 c0000000 00000000 10000000 04000300 0006400a 40004000 00002e00 |