On Target PTAFR_HUMAN 0.58064514/CHEMBL297624
For the given ligand Tramadol, we have found in our database that, being scored 0.58064514, the most similar ligand is CHEMBL297624. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL297624 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cc(cc(OC)c1OC)[C@H]2CC[C@@H](O2)c3cc(OC)c(OC)c(OC)c3 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000001 4b000008 2000010a 00010200 00081010 40004000 42040000 00000000 00000900 00080848 08100000 40008000 00004002 20210000 01080005 02088008 00000000 02000204 00482000 00020a01 00000120 08000020 01000000 00400010 00000400 80002000 005a0000 00000000 00000202 0002000a 40000000 02000400 |