On Target AA1R_HUMAN 0.37908497/CHEMBL3317576
For the given ligand Tramadol, we have found in our database that, being scored 0.37908497, the most similar ligand is CHEMBL3317576. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL3317576 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cccc(CCCc2nc(N)c3nn(cc3n2)c4ccccc4)c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 0000000e c3800208 2008150a 18090620 01081060 4000c000 07009010 00001800 10100900 000d18c0 09108004 40819000 00000802 20a00000 010200c1 020c000c 10000000 06000008 01680008 00260601 c0000100 18018060 25800840 83400010 00100000 80000000 08010000 00000880 0400020c 00c6080a 40040000 a02405e0 |