On Target NK1R_HUMAN 0.5816327/CHEMBL140101
For the given ligand Tramadol, we have found in our database that, being scored 0.5816327, the most similar ligand is CHEMBL140101. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL140101 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | COc1cc(COCC2(CCNCC2)c3ccccc3)cc(OC)c1 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000001 49000208 20100108 00010700 00101050 00004000 42000000 20000040 00000900 000808c8 08300000 50018000 00000002 00010000 01040005 020c1008 08000000 02000004 04480000 00020a01 00010120 18000020 01000000 00400010 00000400 80002000 00080200 10000000 00000200 0006000a 40000000 02000e00 |