On Target MC4R_HUMAN 0.47560975/CHEMBL195998
For the given ligand Tramadol, we have found in our database that, being scored 0.47560975, the most similar ligand is CHEMBL195998. Check out the elaboration below.
| Tramadol (Given Ligand) | CHEMBL195998 (Similar Ligand) |
|---|---|
| COc2cccc(C1(O)CCCCC1CN(C)C)c2 | CCN(CC)CC(CCc1ccccc1)N2CCN(C)CC2 |
|
|
|
|
|
|
| 00000000 4b000208 2010010a 00010600 00081000 40004000 02000000 00000000 00000900 000808c0 08300000 40018000 00000002 20a00000 01000005 000c0008 00000000 02000000 02c82000 00020201 00000100 18000030 01000080 00500010 00000000 80000000 00000000 10000000 00000202 0006000a 40020000 00000600 | 00000000 01000200 00100102 04010600 00000000 00000000 00000000 20000000 00100800 000808c0 08300000 40018000 00000002 00202000 00000000 00040000 00000000 02000000 00000000 00000201 00000100 38000000 00000023 02500010 00000000 80000000 00000000 10000000 08000000 0006000a 00000000 00000600 |