On Target CCKAR_HUMAN 0.2888889/CHEMBL249151
For the given ligand Heroin, we have found in our database that, being scored 0.2888889, the most similar ligand is CHEMBL249151. Check out the elaboration below.
| Heroin (Given Ligand) | CHEMBL249151 (Similar Ligand) |
|---|---|
| CC(=O)Oc1ccc2CC5C3/C=C\C(OC(C)=O)C4Oc1c2C34CCN5C | COc1ccc(cc1)n2nc(CC(C(=O)O)c3cccc(OC)c3)cc2c4ccc(C)cc4 |
|
|
|
|
|
|
| 04001000 cb000208 20100d0a 80310700 00181061 c2000802 020c1000 38000643 00002890 001818ca 48300300 51818040 0082c202 21a00080 11250425 020cb018 08820200 22008060 24492012 0002a201 00000120 18200a10 1500e040 89540410 02201400 c0002401 04524200 90800024 04000302 0007cc0a 24020000 10812f50 | 02006006 42000208 a0000108 00018600 01085041 40004002 02440000 00001208 00000904 000d08c0 09108004 60029048 0d008812 20000200 41840041 000c200c 48020000 06801000 04480018 10220241 40100100 1851aa20 358008c0 83404418 00002800 c00000c0 10160000 00010861 04004304 0046000a 40062200 830005a2 |